C16H21N3 — CID 80952496
2-propan-2-yl-6-(2,4,5-trimethylphenyl)pyrimidin-4-amine (PubChem CID 80952496) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-propan-2-yl-6-(2,4,5-trimethylphenyl)pyrimidin-4-amine.
| Compound Name | 2-propan-2-yl-6-(2,4,5-trimethylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80952496 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-propan-2-yl-6-(2,4,5-trimethylphenyl)pyrimidin-4-amine |
| SMILES | Cc1cc(C)c(-c2cc(N)nc(C(C)C)n2)cc1C |
| InChI | InChI=1S/C16H21N3/c1-9(2)16-18-14(8-15(17)19-16)13-7-11(4)10(3)6-12(13)5/h6-9H,1-5H3,(H2,17,18,19) |
| InChIKey | SOMAINWYRCUDCR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |