C14H17BrClN3S — CID 80953513
N-[(4-bromothiophen-2-yl)methyl]-2-tert-butyl-6-chloro-N-methylpyrimidin-4-amine (PubChem CID 80953513) has the molecular formula C14H17BrClN3S and a molecular weight of 374.74 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-tert-butyl-6-chloro-N-methylpyrimidin-4-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-tert-butyl-6-chloro-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80953513 |
| Molecular Formula | C14H17BrClN3S |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-tert-butyl-6-chloro-N-methylpyrimidin-4-amine |
| SMILES | CN(Cc1cc(Br)cs1)c1cc(Cl)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H17BrClN3S/c1-14(2,3)13-17-11(16)6-12(18-13)19(4)7-10-5-9(15)8-20-10/h5-6,8H,7H2,1-4H3 |
| InChIKey | JTFHPIGDXMZJEK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |