C11H11BrClN3S — CID 107373412
N-[(4-bromothiophen-2-yl)methyl]-5-(chloromethyl)-N-methylpyrazin-2-amine (PubChem CID 107373412) has the molecular formula C11H11BrClN3S and a molecular weight of 332.65 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-5-(chloromethyl)-N-methylpyrazin-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-5-(chloromethyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 107373412 |
| Molecular Formula | C11H11BrClN3S |
| Molecular Weight | 332.65 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-5-(chloromethyl)-N-methylpyrazin-2-amine |
| SMILES | CN(Cc1cc(Br)cs1)c1cnc(CCl)cn1 |
| InChI | InChI=1S/C11H11BrClN3S/c1-16(6-10-2-8(12)7-17-10)11-5-14-9(3-13)4-15-11/h2,4-5,7H,3,6H2,1H3 |
| InChIKey | MHEVRBAAXMIDMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.65 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|