C16H28N4 — CID 80958618
2-tert-butyl-6-(4,4-dimethylazepan-1-yl)pyrimidin-4-amine (PubChem CID 80958618) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-tert-butyl-6-(4,4-dimethylazepan-1-yl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(4,4-dimethylazepan-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80958618 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-tert-butyl-6-(4,4-dimethylazepan-1-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CCCN(c2cc(N)nc(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C16H28N4/c1-15(2,3)14-18-12(17)11-13(19-14)20-9-6-7-16(4,5)8-10-20/h11H,6-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | ACVCHQVSJOWPLY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |