C14H25N3OS — CID 80964135
3-[2-tert-butyl-6-(ethylamino)pyrimidin-4-yl]sulfanylbutan-1-ol (PubChem CID 80964135) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 3-[2-tert-butyl-6-(ethylamino)pyrimidin-4-yl]sulfanylbutan-1-ol.
| Compound Name | 3-[2-tert-butyl-6-(ethylamino)pyrimidin-4-yl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 80964135 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[2-tert-butyl-6-(ethylamino)pyrimidin-4-yl]sulfanylbutan-1-ol |
| SMILES | CCNc1cc(SC(C)CCO)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H25N3OS/c1-6-15-11-9-12(19-10(2)7-8-18)17-13(16-11)14(3,4)5/h9-10,18H,6-8H2,1-5H3,(H,15,16,17) |
| InChIKey | YBIHJSOJAIJYHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |