C14H15Cl2N3S — CID 80965067
2-tert-butyl-6-(3,4-dichlorophenyl)sulfanylpyrimidin-4-amine (PubChem CID 80965067) has the molecular formula C14H15Cl2N3S and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-tert-butyl-6-(3,4-dichlorophenyl)sulfanylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(3,4-dichlorophenyl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80965067 |
| Molecular Formula | C14H15Cl2N3S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-tert-butyl-6-(3,4-dichlorophenyl)sulfanylpyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(N)cc(Sc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H15Cl2N3S/c1-14(2,3)13-18-11(17)7-12(19-13)20-8-4-5-9(15)10(16)6-8/h4-7H,1-3H3,(H2,17,18,19) |
| InChIKey | BLZKEJHDHCNGDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |