C15H21N5S — CID 80968402
[2-tert-butyl-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80968402) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is [2-tert-butyl-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80968402 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [2-tert-butyl-6-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1nc(NN)cc(N2CCc3sccc3C2)n1 |
| InChI | InChI=1S/C15H21N5S/c1-15(2,3)14-17-12(19-16)8-13(18-14)20-6-4-11-10(9-20)5-7-21-11/h5,7-8H,4,6,9,16H2,1-3H3,(H,17,18,19) |
| InChIKey | WMFDUBYIBAYBON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|