C13H12F3N5 — CID 80969109
2-cyclopropyl-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyrimidin-4-amine (PubChem CID 80969109) has the molecular formula C13H12F3N5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80969109 |
| Molecular Formula | C13H12F3N5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-N-(2,4,6-trifluorophenyl)pyrimidin-4-amine |
| SMILES | NNc1cc(Nc2c(F)cc(F)cc2F)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H12F3N5/c14-7-3-8(15)12(9(16)4-7)18-10-5-11(21-17)20-13(19-10)6-1-2-6/h3-6H,1-2,17H2,(H2,18,19,20,21) |
| InChIKey | XMZVFQRHPPYCII-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|