C16H22ClN3S — CID 80970400
6-chloro-5-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-ylpyrimidin-4-amine (PubChem CID 80970400) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is 6-chloro-5-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80970400 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 6-chloro-5-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)-2-propan-2-ylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C(C)C)nc1NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C16H22ClN3S/c1-10(2)14-19-13(17)11(3)15(20-14)18-9-16(4,5)12-7-6-8-21-12/h6-8,10H,9H2,1-5H3,(H,18,19,20) |
| InChIKey | FKTRHPWATIKUTE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |