C14H14ClF2N3 — CID 80970481
6-chloro-N-(3,5-difluorophenyl)-5-methyl-2-propylpyrimidin-4-amine (PubChem CID 80970481) has the molecular formula C14H14ClF2N3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 6-chloro-N-(3,5-difluorophenyl)-5-methyl-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(3,5-difluorophenyl)-5-methyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80970481 |
| Molecular Formula | C14H14ClF2N3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-chloro-N-(3,5-difluorophenyl)-5-methyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)c(C)c(Nc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C14H14ClF2N3/c1-3-4-12-19-13(15)8(2)14(20-12)18-11-6-9(16)5-10(17)7-11/h5-7H,3-4H2,1-2H3,(H,18,19,20) |
| InChIKey | HMMYTQVZJSRSNV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |