C14H21ClN4 — CID 80971580
3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]butanenitrile (PubChem CID 80971580) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]butanenitrile.
| Compound Name | 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]butanenitrile |
|---|---|
| PubChem CID | 80971580 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]butanenitrile |
| SMILES | Cc1c(Cl)nc(C(C)(C)C)nc1N(C)C(C)CC#N |
| InChI | InChI=1S/C14H21ClN4/c1-9(7-8-16)19(6)12-10(2)11(15)17-13(18-12)14(3,4)5/h9H,7H2,1-6H3 |
| InChIKey | GEWXDLCAGDWMTH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |