C14H24ClN3O — CID 80978159
1-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]-2-methylpropan-2-ol (PubChem CID 80978159) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80978159 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)-methylamino]-2-methylpropan-2-ol |
| SMILES | Cc1c(Cl)nc(C(C)(C)C)nc1N(C)CC(C)(C)O |
| InChI | InChI=1S/C14H24ClN3O/c1-9-10(15)16-12(13(2,3)4)17-11(9)18(7)8-14(5,6)19/h19H,8H2,1-7H3 |
| InChIKey | IBOIVSQWJSJXMY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |