C12H21ClN4O2S — CID 80971808
3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)amino]propane-1-sulfonamide (PubChem CID 80971808) has the molecular formula C12H21ClN4O2S and a molecular weight of 320.85 g/mol. Its IUPAC name is 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 80971808 |
| Molecular Formula | C12H21ClN4O2S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-[(2-tert-butyl-6-chloro-5-methylpyrimidin-4-yl)amino]propane-1-sulfonamide |
| SMILES | Cc1c(Cl)nc(C(C)(C)C)nc1NCCCS(N)(=O)=O |
| InChI | InChI=1S/C12H21ClN4O2S/c1-8-9(13)16-11(12(2,3)4)17-10(8)15-6-5-7-20(14,18)19/h5-7H2,1-4H3,(H2,14,18,19)(H,15,16,17) |
| InChIKey | JDFKFXRJIODXCD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|