C15H21ClN4 — CID 80972393
6-chloro-2-cyclopropyl-N-(1-cyclopropylpyrrolidin-3-yl)-5-methylpyrimidin-4-amine (PubChem CID 80972393) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(1-cyclopropylpyrrolidin-3-yl)-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(1-cyclopropylpyrrolidin-3-yl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80972393 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(1-cyclopropylpyrrolidin-3-yl)-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H21ClN4/c1-9-13(16)18-15(10-2-3-10)19-14(9)17-11-6-7-20(8-11)12-4-5-12/h10-12H,2-8H2,1H3,(H,17,18,19) |
| InChIKey | OAUNRXRRIUUSOA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |