C13H16ClN3 — CID 106196088
6-chloro-N-cyclopent-3-en-1-yl-2-cyclopropyl-5-methylpyrimidin-4-amine (PubChem CID 106196088) has the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. Its IUPAC name is 6-chloro-N-cyclopent-3-en-1-yl-2-cyclopropyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-cyclopent-3-en-1-yl-2-cyclopropyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106196088 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-chloro-N-cyclopent-3-en-1-yl-2-cyclopropyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1NC1CC=CC1 |
| InChI | InChI=1S/C13H16ClN3/c1-8-11(14)16-13(9-6-7-9)17-12(8)15-10-4-2-3-5-10/h2-3,9-10H,4-7H2,1H3,(H,15,16,17) |
| InChIKey | JQPWXDIWOQDJCV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|