C17H20ClN3 — CID 80974160
6-chloro-2-cyclopropyl-5-methyl-N-(4-propan-2-ylphenyl)pyrimidin-4-amine (PubChem CID 80974160) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-5-methyl-N-(4-propan-2-ylphenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-5-methyl-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80974160 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-chloro-2-cyclopropyl-5-methyl-N-(4-propan-2-ylphenyl)pyrimidin-4-amine |
| SMILES | Cc1c(Cl)nc(C2CC2)nc1Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H20ClN3/c1-10(2)12-6-8-14(9-7-12)19-16-11(3)15(18)20-17(21-16)13-4-5-13/h6-10,13H,4-5H2,1-3H3,(H,19,20,21) |
| InChIKey | KALWRSJMDDDPTA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |