C17H32N4 — CID 80976041
4-N,4-N-dibutyl-2-tert-butyl-5-methylpyrimidine-4,6-diamine (PubChem CID 80976041) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-N,4-N-dibutyl-2-tert-butyl-5-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibutyl-2-tert-butyl-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80976041 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 4-N,4-N-dibutyl-2-tert-butyl-5-methylpyrimidine-4,6-diamine |
| SMILES | CCCCN(CCCC)c1nc(C(C)(C)C)nc(N)c1C |
| InChI | InChI=1S/C17H32N4/c1-7-9-11-21(12-10-8-2)15-13(3)14(18)19-16(20-15)17(4,5)6/h7-12H2,1-6H3,(H2,18,19,20) |
| InChIKey | CJIYIGUQWNDKII-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |