C15H29N5 — CID 81000249
2-tert-butyl-6-hydrazinyl-5-methyl-N,N-dipropylpyrimidin-4-amine (PubChem CID 81000249) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-tert-butyl-6-hydrazinyl-5-methyl-N,N-dipropylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-hydrazinyl-5-methyl-N,N-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81000249 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 2-tert-butyl-6-hydrazinyl-5-methyl-N,N-dipropylpyrimidin-4-amine |
| SMILES | CCCN(CCC)c1nc(C(C)(C)C)nc(NN)c1C |
| InChI | InChI=1S/C15H29N5/c1-7-9-20(10-8-2)13-11(3)12(19-16)17-14(18-13)15(4,5)6/h7-10,16H2,1-6H3,(H,17,18,19) |
| InChIKey | LSIZNYCJSITADW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|