C12H19N3O — CID 80988312
N,2-diethyl-5-methyl-6-prop-2-enoxypyrimidin-4-amine (PubChem CID 80988312) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N,2-diethyl-5-methyl-6-prop-2-enoxypyrimidin-4-amine.
| Compound Name | N,2-diethyl-5-methyl-6-prop-2-enoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 80988312 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N,2-diethyl-5-methyl-6-prop-2-enoxypyrimidin-4-amine |
| SMILES | C=CCOc1nc(CC)nc(NCC)c1C |
| InChI | InChI=1S/C12H19N3O/c1-5-8-16-12-9(4)11(13-7-3)14-10(6-2)15-12/h5H,1,6-8H2,2-4H3,(H,13,14,15) |
| InChIKey | YNLURWFLHPNOAC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|