C15H22ClN5 — CID 80989029
2-tert-butyl-6-(4-chloro-3-methylpyrazol-1-yl)-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 80989029) has the molecular formula C15H22ClN5 and a molecular weight of 307.83 g/mol. Its IUPAC name is 2-tert-butyl-6-(4-chloro-3-methylpyrazol-1-yl)-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-(4-chloro-3-methylpyrazol-1-yl)-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80989029 |
| Molecular Formula | C15H22ClN5 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-tert-butyl-6-(4-chloro-3-methylpyrazol-1-yl)-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)(C)C)nc(-n2cc(Cl)c(C)n2)c1C |
| InChI | InChI=1S/C15H22ClN5/c1-7-17-12-9(2)13(19-14(18-12)15(4,5)6)21-8-11(16)10(3)20-21/h8H,7H2,1-6H3,(H,17,18,19) |
| InChIKey | OLHVIWGQSGEXOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |