C10H15N3S — CID 80991192
2-cyclopropyl-6-ethylsulfanyl-5-methylpyrimidin-4-amine (PubChem CID 80991192) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 2-cyclopropyl-6-ethylsulfanyl-5-methylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-ethylsulfanyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80991192 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-cyclopropyl-6-ethylsulfanyl-5-methylpyrimidin-4-amine |
| SMILES | CCSc1nc(C2CC2)nc(N)c1C |
| InChI | InChI=1S/C10H15N3S/c1-3-14-10-6(2)8(11)12-9(13-10)7-4-5-7/h7H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | PYOQJAYLKDJKGT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |