C11H18N4S — CID 81000764
(2-cyclopropyl-5-methyl-6-propylsulfanylpyrimidin-4-yl)hydrazine (PubChem CID 81000764) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is (2-cyclopropyl-5-methyl-6-propylsulfanylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-cyclopropyl-5-methyl-6-propylsulfanylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 81000764 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2-cyclopropyl-5-methyl-6-propylsulfanylpyrimidin-4-yl)hydrazine |
| SMILES | CCCSc1nc(C2CC2)nc(NN)c1C |
| InChI | InChI=1S/C11H18N4S/c1-3-6-16-11-7(2)9(15-12)13-10(14-11)8-4-5-8/h8H,3-6,12H2,1-2H3,(H,13,14,15) |
| InChIKey | FQEFCOXEHMITKU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|