C11H19N5O2S — CID 80993649
N-[2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 80993649) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80993649 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[2-[(6-amino-2-cyclopropyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1c(N)nc(C2CC2)nc1NCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H19N5O2S/c1-7-9(12)15-11(8-3-4-8)16-10(7)13-5-6-14-19(2,17)18/h8,14H,3-6H2,1-2H3,(H3,12,13,15,16) |
| InChIKey | WZYSRZGAODLHSI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|