C12H22N6O2S — CID 106341084
2-[(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide (PubChem CID 106341084) has the molecular formula C12H22N6O2S and a molecular weight of 314.42 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106341084 |
| Molecular Formula | C12H22N6O2S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1nc(C2CC2)nc(NN)c1C |
| InChI | InChI=1S/C12H22N6O2S/c1-3-15-21(19,20)7-6-14-10-8(2)11(18-13)17-12(16-10)9-4-5-9/h9,15H,3-7,13H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | QEJKKUZNWQMCJE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|