C13H19N7 — CID 80994731
2-cyclopropyl-6-hydrazinyl-5-methyl-N-(2-pyrazol-1-ylethyl)pyrimidin-4-amine (PubChem CID 80994731) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-5-methyl-N-(2-pyrazol-1-ylethyl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-5-methyl-N-(2-pyrazol-1-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80994731 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-5-methyl-N-(2-pyrazol-1-ylethyl)pyrimidin-4-amine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1NCCn1cccn1 |
| InChI | InChI=1S/C13H19N7/c1-9-11(15-6-8-20-7-2-5-16-20)17-13(10-3-4-10)18-12(9)19-14/h2,5,7,10H,3-4,6,8,14H2,1H3,(H2,15,17,18,19) |
| InChIKey | UUXMJBUODSICDN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|