C13H22N4O2S — CID 80994169
4-N-(1,1-dioxothian-4-yl)-5-methyl-2-propylpyrimidine-4,6-diamine (PubChem CID 80994169) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-N-(1,1-dioxothian-4-yl)-5-methyl-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,1-dioxothian-4-yl)-5-methyl-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80994169 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-N-(1,1-dioxothian-4-yl)-5-methyl-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)c(C)c(NC2CCS(=O)(=O)CC2)n1 |
| InChI | InChI=1S/C13H22N4O2S/c1-3-4-11-16-12(14)9(2)13(17-11)15-10-5-7-20(18,19)8-6-10/h10H,3-8H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | GGXLFFVPRMRXQH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |