C11H16ClN3O2S — CID 63271422
6-chloro-N-(1,1-dioxothian-4-yl)-4,5-dimethylpyridazin-3-amine (PubChem CID 63271422) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothian-4-yl)-4,5-dimethylpyridazin-3-amine.
| Compound Name | 6-chloro-N-(1,1-dioxothian-4-yl)-4,5-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 63271422 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothian-4-yl)-4,5-dimethylpyridazin-3-amine |
| SMILES | Cc1c(Cl)nnc(NC2CCS(=O)(=O)CC2)c1C |
| InChI | InChI=1S/C11H16ClN3O2S/c1-7-8(2)11(15-14-10(7)12)13-9-3-5-18(16,17)6-4-9/h9H,3-6H2,1-2H3,(H,13,15) |
| InChIKey | WSJDEUPDSCNFCK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |