C13H23N5S — CID 80994402
6-hydrazinyl-N,5-dimethyl-2-propyl-N-(thiolan-3-yl)pyrimidin-4-amine (PubChem CID 80994402) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is 6-hydrazinyl-N,5-dimethyl-2-propyl-N-(thiolan-3-yl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,5-dimethyl-2-propyl-N-(thiolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80994402 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-hydrazinyl-N,5-dimethyl-2-propyl-N-(thiolan-3-yl)pyrimidin-4-amine |
| SMILES | CCCc1nc(NN)c(C)c(N(C)C2CCSC2)n1 |
| InChI | InChI=1S/C13H23N5S/c1-4-5-11-15-12(17-14)9(2)13(16-11)18(3)10-6-7-19-8-10/h10H,4-8,14H2,1-3H3,(H,15,16,17) |
| InChIKey | GRJWYIANJCJGCQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|