C13H21N5S — CID 80995592
2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-(thiolan-3-yl)pyrimidin-4-amine (PubChem CID 80995592) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-(thiolan-3-yl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-(thiolan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80995592 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-(thiolan-3-yl)pyrimidin-4-amine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1N(C)C1CCSC1 |
| InChI | InChI=1S/C13H21N5S/c1-8-11(17-14)15-12(9-3-4-9)16-13(8)18(2)10-5-6-19-7-10/h9-10H,3-7,14H2,1-2H3,(H,15,16,17) |
| InChIKey | NESXWNORNIKCRW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|