C15H18FN5 — CID 81007580
2-cyclopropyl-N-(3-fluorophenyl)-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 81007580) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-cyclopropyl-N-(3-fluorophenyl)-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-(3-fluorophenyl)-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 81007580 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-cyclopropyl-N-(3-fluorophenyl)-6-hydrazinyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C15H18FN5/c1-9-13(20-17)18-14(10-6-7-10)19-15(9)21(2)12-5-3-4-11(16)8-12/h3-5,8,10H,6-7,17H2,1-2H3,(H,18,19,20) |
| InChIKey | BSYDXTJFWPWUOW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|