C14H20N6S — CID 81006384
2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine (PubChem CID 81006384) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 81006384 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-N,5-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1nc(CN(C)c2nc(C3CC3)nc(NN)c2C)cs1 |
| InChI | InChI=1S/C14H20N6S/c1-8-12(19-15)17-13(10-4-5-10)18-14(8)20(3)6-11-7-21-9(2)16-11/h7,10H,4-6,15H2,1-3H3,(H,17,18,19) |
| InChIKey | NFUCOJBGVFZQOT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|