C12H24N6O2S — CID 80994504
N-[2-[(2-tert-butyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 80994504) has the molecular formula C12H24N6O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[2-[(2-tert-butyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(2-tert-butyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 80994504 |
| Molecular Formula | C12H24N6O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[2-[(2-tert-butyl-6-hydrazinyl-5-methylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1c(NN)nc(C(C)(C)C)nc1NCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H24N6O2S/c1-8-9(14-6-7-15-21(5,19)20)16-11(12(2,3)4)17-10(8)18-13/h15H,6-7,13H2,1-5H3,(H2,14,16,17,18) |
| InChIKey | DGJNGZGVYVMMPV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|