C12H20F3N5 — CID 81006696
2-tert-butyl-6-hydrazinyl-5-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 81006696) has the molecular formula C12H20F3N5 and a molecular weight of 291.32 g/mol. Its IUPAC name is 2-tert-butyl-6-hydrazinyl-5-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
| Compound Name | 2-tert-butyl-6-hydrazinyl-5-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 81006696 |
| Molecular Formula | C12H20F3N5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-tert-butyl-6-hydrazinyl-5-methyl-N-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | Cc1c(NN)nc(C(C)(C)C)nc1NCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3N5/c1-7-8(17-6-5-12(13,14)15)18-10(11(2,3)4)19-9(7)20-16/h5-6,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | ZCYPUZVFBBHPIH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|