C16H26N2S — CID 80996992
N-cyclopropyl-2-[(propan-2-ylamino)methyl]-N-(thiophen-2-ylmethyl)cyclobutan-1-amine (PubChem CID 80996992) has the molecular formula C16H26N2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N-cyclopropyl-2-[(propan-2-ylamino)methyl]-N-(thiophen-2-ylmethyl)cyclobutan-1-amine.
| Compound Name | N-cyclopropyl-2-[(propan-2-ylamino)methyl]-N-(thiophen-2-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 80996992 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-cyclopropyl-2-[(propan-2-ylamino)methyl]-N-(thiophen-2-ylmethyl)cyclobutan-1-amine |
| SMILES | CC(C)NCC1CCC1N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H26N2S/c1-12(2)17-10-13-5-8-16(13)18(14-6-7-14)11-15-4-3-9-19-15/h3-4,9,12-14,16-17H,5-8,10-11H2,1-2H3 |
| InChIKey | OOJJQDQCQVJYHZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |