C11H16N2S — CID 62784619
N-cyclopropyl-N-(thiophen-2-ylmethyl)azetidin-3-amine (PubChem CID 62784619) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-cyclopropyl-N-(thiophen-2-ylmethyl)azetidin-3-amine.
| Compound Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)azetidin-3-amine |
|---|---|
| PubChem CID | 62784619 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)azetidin-3-amine |
| SMILES | c1csc(CN(C2CC2)C2CNC2)c1 |
| InChI | InChI=1S/C11H16N2S/c1-2-11(14-5-1)8-13(9-3-4-9)10-6-12-7-10/h1-2,5,9-10,12H,3-4,6-8H2 |
| InChIKey | PGQQOSBTZSHUOH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |