C8H15NO2S — CID 80997344
2-(1-aminopropan-2-ylsulfanyl)cyclobutane-1-carboxylic acid (PubChem CID 80997344) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-(1-aminopropan-2-ylsulfanyl)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(1-aminopropan-2-ylsulfanyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 80997344 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-(1-aminopropan-2-ylsulfanyl)cyclobutane-1-carboxylic acid |
| SMILES | CC(CN)SC1CCC1C(=O)O |
| InChI | InChI=1S/C8H15NO2S/c1-5(4-9)12-7-3-2-6(7)8(10)11/h5-7H,2-4,9H2,1H3,(H,10,11) |
| InChIKey | WCRNSTGOWJSJFE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |