C12H22O2S — CID 63098596
4-methyl-2-(2-methylpropylsulfanyl)cyclohexane-1-carboxylic acid (PubChem CID 63098596) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is 4-methyl-2-(2-methylpropylsulfanyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-2-(2-methylpropylsulfanyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63098596 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-methyl-2-(2-methylpropylsulfanyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CSC1CC(C)CCC1C(=O)O |
| InChI | InChI=1S/C12H22O2S/c1-8(2)7-15-11-6-9(3)4-5-10(11)12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | KSZQVZFSGKNUBM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |