C17H24O2S — CID 63529806
4-methyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexane-1-carboxylic acid (PubChem CID 63529806) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is 4-methyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63529806 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-methyl-2-(4-propan-2-ylphenyl)sulfanylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)C(Sc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C17H24O2S/c1-11(2)13-5-7-14(8-6-13)20-16-10-12(3)4-9-15(16)17(18)19/h5-8,11-12,15-16H,4,9-10H2,1-3H3,(H,18,19) |
| InChIKey | ONEJEGUZKNSLKJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |