C16H30O2S — CID 107760845
4-tert-butyl-2-(3-methylbutylsulfanyl)cyclohexane-1-carboxylic acid (PubChem CID 107760845) has the molecular formula C16H30O2S and a molecular weight of 286.48 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-methylbutylsulfanyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-2-(3-methylbutylsulfanyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107760845 |
| Molecular Formula | C16H30O2S |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-tert-butyl-2-(3-methylbutylsulfanyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCSC1CC(C(C)(C)C)CCC1C(=O)O |
| InChI | InChI=1S/C16H30O2S/c1-11(2)8-9-19-14-10-12(16(3,4)5)6-7-13(14)15(17)18/h11-14H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | JDLQDEQTMMPGEB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |