C16H22BrClN2O — CID 80999167
4-bromo-3-chloro-N-cyclopentyl-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 80999167) has the molecular formula C16H22BrClN2O and a molecular weight of 373.72 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-cyclopentyl-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-bromo-3-chloro-N-cyclopentyl-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 80999167 |
| Molecular Formula | C16H22BrClN2O |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-bromo-3-chloro-N-cyclopentyl-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCN(C(=O)c1ccc(Br)c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C16H22BrClN2O/c1-19(2)9-10-20(13-5-3-4-6-13)16(21)12-7-8-14(17)15(18)11-12/h7-8,11,13H,3-6,9-10H2,1-2H3 |
| InChIKey | TVGKJXPJBRPWGF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |