C16H22BrClN2O — CID 81294148
N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-chloro-N-ethylbenzamide (PubChem CID 81294148) has the molecular formula C16H22BrClN2O and a molecular weight of 373.72 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-chloro-N-ethylbenzamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-chloro-N-ethylbenzamide |
|---|---|
| PubChem CID | 81294148 |
| Molecular Formula | C16H22BrClN2O |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-bromo-3-chloro-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Br)c(Cl)c1)C1CCCCC1CN |
| InChI | InChI=1S/C16H22BrClN2O/c1-2-20(15-6-4-3-5-12(15)10-19)16(21)11-7-8-13(17)14(18)9-11/h7-9,12,15H,2-6,10,19H2,1H3 |
| InChIKey | LHEYDEDKLGVHFU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |