C17H25BrN2O — CID 115999669
N-[2-(aminomethyl)cyclohexyl]-3-bromo-N-ethyl-5-methylbenzamide (PubChem CID 115999669) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-bromo-N-ethyl-5-methylbenzamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-bromo-N-ethyl-5-methylbenzamide |
|---|---|
| PubChem CID | 115999669 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-bromo-N-ethyl-5-methylbenzamide |
| SMILES | CCN(C(=O)c1cc(C)cc(Br)c1)C1CCCCC1CN |
| InChI | InChI=1S/C17H25BrN2O/c1-3-20(16-7-5-4-6-13(16)11-19)17(21)14-8-12(2)9-15(18)10-14/h8-10,13,16H,3-7,11,19H2,1-2H3 |
| InChIKey | SVSWRWGTVTWQPZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |