C13H21N7 — CID 81000939
[2-tert-butyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 81000939) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is [2-tert-butyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-tert-butyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81000939 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [2-tert-butyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C)n(-c2nc(C(C)(C)C)nc(NN)c2C)n1 |
| InChI | InChI=1S/C13H21N7/c1-7-10(18-14)16-12(13(4,5)6)17-11(7)20-9(3)15-8(2)19-20/h14H2,1-6H3,(H,16,17,18) |
| InChIKey | XKWUHZQATUZJBC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|