C14H25N5 — CID 81006695
(2-tert-butyl-5-methyl-6-piperidin-1-ylpyrimidin-4-yl)hydrazine (PubChem CID 81006695) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is (2-tert-butyl-5-methyl-6-piperidin-1-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-tert-butyl-5-methyl-6-piperidin-1-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 81006695 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | (2-tert-butyl-5-methyl-6-piperidin-1-ylpyrimidin-4-yl)hydrazine |
| SMILES | Cc1c(NN)nc(C(C)(C)C)nc1N1CCCCC1 |
| InChI | InChI=1S/C14H25N5/c1-10-11(18-15)16-13(14(2,3)4)17-12(10)19-8-6-5-7-9-19/h5-9,15H2,1-4H3,(H,16,17,18) |
| InChIKey | VDRRRUTUEZQJLC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|