C13H20N6O — CID 81006699
4-(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)-3-methylpiperazin-2-one (PubChem CID 81006699) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)-3-methylpiperazin-2-one.
| Compound Name | 4-(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 81006699 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-(2-cyclopropyl-6-hydrazinyl-5-methylpyrimidin-4-yl)-3-methylpiperazin-2-one |
| SMILES | Cc1c(NN)nc(C2CC2)nc1N1CCNC(=O)C1C |
| InChI | InChI=1S/C13H20N6O/c1-7-10(18-14)16-11(9-3-4-9)17-12(7)19-6-5-15-13(20)8(19)2/h8-9H,3-6,14H2,1-2H3,(H,15,20)(H,16,17,18) |
| InChIKey | UNNPCNMDJLZATB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|