C16H25N5 — CID 82744561
[6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-cyclopropyl-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 82744561) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-cyclopropyl-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-cyclopropyl-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82744561 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [6-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-cyclopropyl-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C16H25N5/c1-10-14(20-17)18-15(12-6-7-12)19-16(10)21-9-8-11-4-2-3-5-13(11)21/h11-13H,2-9,17H2,1H3,(H,18,19,20) |
| InChIKey | IYHORLNKYSMHAG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|