4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid

C12H20N2O2 — CID 81007921

IUPAC4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid
SMILESCCc1cc(CCC(C)C(=O)O)n(CC)n1
InChIInChI=1S/C12H20N2O2/c1-4-10-8-11(14(5-2)13-10)7-6-9(3)12(15)16/h8-9H,4-7H2,1-3H3,(H,15,16)
InChIKeyINYQWHVRQGFCAN-UHFFFAOYSA-N
MW224.30 g/mol
LogP2.12
Rot. Bonds6

About 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid

4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid (PubChem CID 81007921) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid.

Molecular Properties

Compound Name4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid
PubChem CID81007921
Molecular FormulaC12H20N2O2
Molecular Weight224.30 g/mol
Exact Mass224.15
IUPAC Name4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid
SMILESCCc1cc(CCC(C)C(=O)O)n(CC)n1
InChIInChI=1S/C12H20N2O2/c1-4-10-8-11(14(5-2)13-10)7-6-9(3)12(15)16/h8-9H,4-7H2,1-3H3,(H,15,16)
InChIKeyINYQWHVRQGFCAN-UHFFFAOYSA-N
XLogP2.12
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid?
The IUPAC name of 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid (CID 81007921) is 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid.
What is the SMILES notation for 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid?
The canonical SMILES for 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid is CCc1cc(CCC(C)C(=O)O)n(CC)n1.
What is the InChIKey of 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid?
The InChIKey is INYQWHVRQGFCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-4-10-8-11(14(5-2)13-10)7-6-9(3)12(15)16/h8-9H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid?
4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid has a molecular weight of 224.30 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-diethylpyrazol-5-yl)-2-methylbutanoic acid is sourced from PubChem (CID 81007921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).