C10H24N2 — CID 81011772
1-N,3-N-diethyl-3-N,2-dimethylbutane-1,3-diamine (PubChem CID 81011772) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 1-N,3-N-diethyl-3-N,2-dimethylbutane-1,3-diamine.
| Compound Name | 1-N,3-N-diethyl-3-N,2-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 81011772 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 1-N,3-N-diethyl-3-N,2-dimethylbutane-1,3-diamine |
| SMILES | CCNCC(C)C(C)N(C)CC |
| InChI | InChI=1S/C10H24N2/c1-6-11-8-9(3)10(4)12(5)7-2/h9-11H,6-8H2,1-5H3 |
| InChIKey | RZDUYUBPUBNSGV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |