C15H25F3O3 — CID 81013437
4-propan-2-yl-2-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid (PubChem CID 81013437) has the molecular formula C15H25F3O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-propan-2-yl-2-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-propan-2-yl-2-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81013437 |
| Molecular Formula | C15H25F3O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-propan-2-yl-2-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)C1CCC(C(=O)O)C(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C15H25F3O3/c1-10(2)11-5-6-13(14(19)20)12(8-11)4-3-7-21-9-15(16,17)18/h10-13H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | FGANDFVGGFUDBL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|