C10H15F3O3 — CID 81008690
2-[3-(2,2,2-trifluoroethoxy)propyl]cyclobutane-1-carboxylic acid (PubChem CID 81008690) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethoxy)propyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81008690 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethoxy)propyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1CCCOCC(F)(F)F |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)6-16-5-1-2-7-3-4-8(7)9(14)15/h7-8H,1-6H2,(H,14,15) |
| InChIKey | KRZYSYXWVYDZKM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|